EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
CHEBI:194453 - 10-hydroxypalmitic acid
| Formula | C16H32O3 |
| Net Charge | 0 |
| Average Mass | 272.429 |
| Monoisotopic Mass | 272.23514 |
| SMILES | CCCCCCC(O)CCCCCCCCC(=O)O |
| InChI | InChI=1S/C16H32O3/c1-2-3-4-9-12-15(17)13-10-7-5-6-8-11-14-16(18)19/h15,17H,2-14H2,1H3,(H,18,19) |
| InChIKey | QUFMVAWAOYDYFV-UHFFFAOYSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Escherichia coli BL21 (ncbitaxon:511693) | - | PubMed (26956722) | |
| Homo sapiens (ncbitaxon:9606) | - | PubMed (9397400) | Found in adipocere. |
| Roles Classification |
|---|
| Chemical Roles: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Roles: | human metabolite Any mammalian metabolite produced during a metabolic reaction in humans (Homo sapiens). Escherichia coli metabolite Any bacterial metabolite produced during a metabolic reaction in Escherichia coli. metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 10-hydroxypalmitic acid (CHEBI:194453) has role Escherichia coli metabolite (CHEBI:76971) |
| 10-hydroxypalmitic acid (CHEBI:194453) has role human metabolite (CHEBI:77746) |
| 10-hydroxypalmitic acid (CHEBI:194453) is a hydroxypalmitic acid (CHEBI:72726) |
| 10-hydroxypalmitic acid (CHEBI:194453) is conjugate acid of 10-hydroxypalmitate (CHEBI:194446) |
| Incoming Relation(s) |
| 10-hydroxypalmitate (CHEBI:194446) is conjugate base of 10-hydroxypalmitic acid (CHEBI:194453) |
| IUPAC Name |
|---|
| 10-hydroxyhexadecanoic acid |
| Synonym | Source |
|---|---|
| 10-hydroxy-hexadecanoic acid | ChEBI |
| Manual Xrefs | Databases |
|---|---|
| HMDB0112188 | HMDB |
| Registry Numbers | Sources |
|---|---|
| CAS:23048-75-1 | PubChem Compound |
| Citations |
|---|