EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C19H19N3O2 |
| Net Charge | 0 |
| Average Mass | 321.380 |
| Monoisotopic Mass | 321.14773 |
| SMILES | COc1ccccc1C1C(C#N)=C(N)Oc2cc(N(C)C)ccc21 |
| InChI | InChI=1S/C19H19N3O2/c1-22(2)12-8-9-14-17(10-12)24-19(21)15(11-20)18(14)13-6-4-5-7-16(13)23-3/h4-10,18H,21H2,1-3H3 |
| InChIKey | FUBZFCWMCGQOOE-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Biological Role: | apoptosis inducer Any substance that induces the process of apoptosis (programmed cell death) in multi-celled organisms. |
| Applications: | antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. angiogenesis inhibitor An agent and endogenous substances that antagonize or inhibit the development of new blood vessels. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 2-amino-3-cyano-7-(dimethylamino)-4-(2-methoxyphenyl)-4H-chromene (CHEBI:194427) has role angiogenesis inhibitor (CHEBI:48422) |
| 2-amino-3-cyano-7-(dimethylamino)-4-(2-methoxyphenyl)-4H-chromene (CHEBI:194427) has role antineoplastic agent (CHEBI:35610) |
| 2-amino-3-cyano-7-(dimethylamino)-4-(2-methoxyphenyl)-4H-chromene (CHEBI:194427) has role apoptosis inducer (CHEBI:68495) |
| 2-amino-3-cyano-7-(dimethylamino)-4-(2-methoxyphenyl)-4H-chromene (CHEBI:194427) is a aminochromene (CHEBI:38676) |
| 2-amino-3-cyano-7-(dimethylamino)-4-(2-methoxyphenyl)-4H-chromene (CHEBI:194427) is a monomethoxybenzene (CHEBI:25235) |
| 2-amino-3-cyano-7-(dimethylamino)-4-(2-methoxyphenyl)-4H-chromene (CHEBI:194427) is a nitrile (CHEBI:18379) |
| 2-amino-3-cyano-7-(dimethylamino)-4-(2-methoxyphenyl)-4H-chromene (CHEBI:194427) is a primary amino compound (CHEBI:50994) |
| 2-amino-3-cyano-7-(dimethylamino)-4-(2-methoxyphenyl)-4H-chromene (CHEBI:194427) is a tertiary amino compound (CHEBI:50996) |
| IUPAC Name |
|---|
| 2-amino-7-(dimethylamino)-4-(2-methoxyphenyl)-4H-chromene-3-carbonitrile |
| Synonyms | Source |
|---|---|
| 2-amino-7-(dimethylamino)-4-(2-methoxyphenyl)-4H-1-benzopyran-3-carbonitrile | IUPAC |
| 2-amino-4-(2-methoxyphenyl)-3-cyano-7-(dimethylamino)-4H-chromene | ChEBI |
| Citations |
|---|