EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C26H45NO8S |
| Net Charge | 0 |
| Average Mass | 531.712 |
| Monoisotopic Mass | 531.28659 |
| SMILES | [H][C@]12CC(O)C3[C@]([H])(C[C@H](O)[C@@]4(C)[C@@]3([H])CC[C@]4([H])[C@H](C)CCC(=O)NCCOS(=O)(=O)O)[C@@]1(C)CC[C@@H](O)C2 |
| InChI | InChI=1S/C26H45NO8S/c1-15(4-7-23(31)27-10-11-35-36(32,33)34)18-5-6-19-24-20(14-22(30)26(18,19)3)25(2)9-8-17(28)12-16(25)13-21(24)29/h15-22,24,28-30H,4-14H2,1-3H3,(H,27,31)(H,32,33,34)/t15-,16+,17-,18-,19+,20+,21?,22+,24?,25+,26-/m1/s1 |
| InChIKey | FZLMIZAHBFKTSH-WVTJEXCRSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Mus musculus (ncbitaxon:10090) | cerebral cortex (BTO:0000233) | MetaboLights (MTBLS6578) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 2-{[(3alpha,5beta,7alpha,8xi,12alpha)-3,7,12-Trihydroxy-24-oxocholan-24-yl]amino}ethyl hydrogen sulfate (CHEBI:194389) is a bile acid (CHEBI:3098) |
| IUPAC Name |
|---|
| 2-[[(4R)-4-[(3R,5S,7R,9S,10S,12S,13R,14S,17R)-3,7,12-trihydroxy-10,13-dimethyl-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-17-yl]pentanoyl]amino]ethyl hydrogen sulate |
| Manual Xrefs | Databases |
|---|---|
| 30791307 | ChemSpider |