EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C8H11NO4 |
| Net Charge | 0 |
| Average Mass | 185.179 |
| Monoisotopic Mass | 185.06881 |
| SMILES | [H][C@@]12[C@@H](C(=O)O)[C@]1([H])CC[C@@]2(N)C(=O)O |
| InChI | InChI=1S/C8H11NO4/c9-8(7(12)13)2-1-3-4(5(3)8)6(10)11/h3-5H,1-2,9H2,(H,10,11)(H,12,13)/t3-,4-,5-,8-/m0/s1 |
| InChIKey | VTAARTQTOOYTES-RGDLXGNYSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Mus musculus (ncbitaxon:10090) | cerebral cortex (BTO:0000233) | MetaboLights (MTBLS6578) |
| Roles Classification |
|---|
| Chemical Roles: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Eglumetad (CHEBI:194387) is a L-α-amino acid (CHEBI:15705) |
| IUPAC Name |
|---|
| (1S,2S,5R,6S)-2-aminobicyclo[3.1.0]hexane-2,6-dicarboxylic acid |