EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C4H7NO2 |
| Net Charge | 0 |
| Average Mass | 101.105 |
| Monoisotopic Mass | 101.04768 |
| SMILES | C=CC(N)C(=O)O |
| InChI | InChI=1S/C4H7NO2/c1-2-3(5)4(6)7/h2-3H,1,5H2,(H,6,7) |
| InChIKey | RQVLGLPAZTUBKX-UHFFFAOYSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Mus musculus (ncbitaxon:10090) | cerebral cortex (BTO:0000233) | MetaboLights (MTBLS6578) |
| Roles Classification |
|---|
| Chemical Roles: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 2-Amino-3-butenoic acid (CHEBI:194385) is a α-amino acid (CHEBI:33704) |
| IUPAC Name |
|---|
| 2-aminobut-3-enoic acid |
| Manual Xrefs | Databases |
|---|---|
| 90320 | ChemSpider |