EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C20H32O2 |
| Net Charge | 0 |
| Average Mass | 304.474 |
| Monoisotopic Mass | 304.24023 |
| SMILES | [H][C@]12CCC(CO)=C[C@H](O)[C@]1(C)CC[C@@]1(C)CCC(C(C)C)=C12 |
| InChI | InChI=1S/C20H32O2/c1-13(2)15-7-8-19(3)9-10-20(4)16(18(15)19)6-5-14(12-21)11-17(20)22/h11,13,16-17,21-22H,5-10,12H2,1-4H3/t16-,17+,19-,20-/m1/s1 |
| InChIKey | ARKJITGRSNWNOF-PIKOESSRSA-N |
| Roles Classification |
|---|
| Biological Role: | fungal metabolite Any eukaryotic metabolite produced during a metabolic reaction in fungi, the kingdom that includes microorganisms such as the yeasts and moulds. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| cyathadiol (CHEBI:194346) has role fungal metabolite (CHEBI:76946) |
| cyathadiol (CHEBI:194346) is a carbotricyclic compound (CHEBI:38032) |
| cyathadiol (CHEBI:194346) is a diol (CHEBI:23824) |
| cyathadiol (CHEBI:194346) is a polycyclic olefin (CHEBI:35714) |
| cyathadiol (CHEBI:194346) is a primary allylic alcohol (CHEBI:134394) |
| cyathadiol (CHEBI:194346) is a secondary allylic alcohol (CHEBI:134396) |
| cyathadiol (CHEBI:194346) is a tricyclic diterpenoid (CHEBI:79084) |
| IUPAC Name |
|---|
| (3aR,5aR,6S,10aR)-8-(hydroxymethyl)-3a,5a-dimethyl-1-(propan-2-yl)-2,3,3a,4,5,5a,6,9,10,10a-decahydrocyclohepta[e]inden-6-ol |
| UniProt Name | Source |
|---|---|
| cyathadiol | UniProt |
| Manual Xrefs | Databases |
|---|---|
| CPD-26038 | MetaCyc |
| Citations |
|---|