EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C19H27ClFN3O2 |
| Net Charge | 0 |
| Average Mass | 383.895 |
| Monoisotopic Mass | 383.17758 |
| SMILES | CC(C)(C)NC(=O)CN1CCC(CNC(=O)c2cc(F)cc(Cl)c2)CC1 |
| InChI | InChI=1S/C19H27ClFN3O2/c1-19(2,3)23-17(25)12-24-6-4-13(5-7-24)11-22-18(26)14-8-15(20)10-16(21)9-14/h8-10,13H,4-7,11-12H2,1-3H3,(H,22,26)(H,23,25) |
| InChIKey | JOCLITFYIMJMNK-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Biological Roles: | T-type calcium channel blocker Any agent that interferes with the activity of T-type calcium channels. non-narcotic analgesic A drug that has principally analgesic, antipyretic and anti-inflammatory actions. Non-narcotic analgesics do not bind to opioid receptors. |
| Application: | non-narcotic analgesic A drug that has principally analgesic, antipyretic and anti-inflammatory actions. Non-narcotic analgesics do not bind to opioid receptors. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| ulixacaltamide (CHEBI:194339) has role non-narcotic analgesic (CHEBI:35481) |
| ulixacaltamide (CHEBI:194339) has role T-type calcium channel blocker (CHEBI:194338) |
| ulixacaltamide (CHEBI:194339) is a benzamides (CHEBI:22702) |
| ulixacaltamide (CHEBI:194339) is a monochlorobenzenes (CHEBI:83403) |
| ulixacaltamide (CHEBI:194339) is a monofluorobenzenes (CHEBI:83575) |
| ulixacaltamide (CHEBI:194339) is a piperidines (CHEBI:26151) |
| ulixacaltamide (CHEBI:194339) is a secondary carboxamide (CHEBI:140325) |
| IUPAC Name |
|---|
| N-({1-[2-(tert-butylamino)-2-oxoethyl]piperidin-4-yl}methyl)-3-chloro-5-fluorobenzamide |
| INNs | Source |
|---|---|
| ulixacaltamidum | WHO MedNet |
| ulixacaltamide | WHO MedNet |
| ulixacaltamide | WHO MedNet |
| ulixacaltamida | WHO MedNet |
| Synonyms | Source |
|---|---|
| Z944 | ChEBI |
| Z 944 | ChEBI |
| Z-944 | ChEBI |
| Manual Xrefs | Databases |
|---|---|
| 29788896 | ChemSpider |
| Registry Numbers | Sources |
|---|---|
| CAS:1199236-64-0 | ChEBI |
| Citations |
|---|