EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C27H48O5 |
| Net Charge | 0 |
| Average Mass | 452.676 |
| Monoisotopic Mass | 452.35017 |
| SMILES | [H][C@@]12C[C@H](O)CC[C@]1(C)[C@@]1([H])C[C@H](O)[C@@]3(C)[C@@]([H])(CC[C@]3([H])[C@H](C)CCCC(C)(O)CO)[C@]1([H])[C@H](O)C2 |
| InChI | InChI=1S/C27H48O5/c1-16(6-5-10-25(2,32)15-28)19-7-8-20-24-21(14-23(31)27(19,20)4)26(3)11-9-18(29)12-17(26)13-22(24)30/h16-24,28-32H,5-15H2,1-4H3/t16-,17+,18-,19-,20+,21+,22-,23+,24+,25?,26+,27-/m1/s1 |
| InChIKey | XZDHXPDYLPEFQI-FIMPYCPFSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Homo sapiens (ncbitaxon:9606) | Urine (NCIT:C13283) | PubMed (11718684) | |
| Rhinella marina (ncbitaxon:8386) | bile (BTO:0000121) | PubMed (7806978) | Species also known as Bufo marinus.. |
| Roles Classification |
|---|
| Biological Roles: | animal metabolite Any eukaryotic metabolite produced during a metabolic reaction in animals that include diverse creatures from sponges, insects to mammals. human urinary metabolite Any metabolite (endogenous or exogenous) found in human urine samples. farnesoid X receptor agonist An agonist that binds to and activates farnesoid X receptors |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 5β-bufol (CHEBI:194331) has role animal metabolite (CHEBI:75767) |
| 5β-bufol (CHEBI:194331) has role human urinary metabolite (CHEBI:84087) |
| 5β-bufol (CHEBI:194331) is a bufol (CHEBI:194332) |
| IUPAC Name |
|---|
| 5β-cholestane-3α,7α,12α,25,26-pentol |
| Synonym | Source |
|---|---|
| (1R,3aS,3bR,4R,5aS,7R,9aS,9bS,11S,11aR)-1-[(2R)-6,7-dihydroxy-6-methylheptan-2-yl]-9a,11a-dimethylhexadecahydro-1H-cyclopenta[a]phenanthrene-4,7,11-triol | ChEBI |
| Manual Xrefs | Databases |
|---|---|
| 4447282 | ChemSpider |
| LMST04030016 | LIPID MAPS |
| Citations |
|---|