EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C23H30N2O2 |
| Net Charge | 0 |
| Average Mass | 366.505 |
| Monoisotopic Mass | 366.23073 |
| SMILES | CCC(=O)N(c1ccccc1)C1CCN(CC(O)c2ccccc2)CC1C |
| InChI | InChI=1S/C23H30N2O2/c1-3-23(27)25(20-12-8-5-9-13-20)21-14-15-24(16-18(21)2)17-22(26)19-10-6-4-7-11-19/h4-13,18,21-22,26H,3,14-17H2,1-2H3 |
| InChIKey | FRPRNNRJTCONEC-UHFFFAOYSA-N |
| Wikipedia |
|---|
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Homo sapiens (ncbitaxon:9606) | peripheral blood mononuclear cell (BTO:0001025) | MetaboLights (MTBLS6661) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Biological Roles: | mu-opioid receptor agonist A compound that exhibits agonist activity at the μ-opioid receptor. opioid analgesic A narcotic or opioid substance, synthetic or semisynthetic agent producing profound analgesia, drowsiness, and changes in mood. |
| Applications: | mu-opioid receptor agonist A compound that exhibits agonist activity at the μ-opioid receptor. opioid analgesic A narcotic or opioid substance, synthetic or semisynthetic agent producing profound analgesia, drowsiness, and changes in mood. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| ohmefentanyl (CHEBI:194294) has role opioid analgesic (CHEBI:35482) |
| ohmefentanyl (CHEBI:194294) has role μ-opioid receptor agonist (CHEBI:55322) |
| ohmefentanyl (CHEBI:194294) is a anilide (CHEBI:13248) |
| ohmefentanyl (CHEBI:194294) is a benzyl alcohols (CHEBI:22743) |
| ohmefentanyl (CHEBI:194294) is a monocarboxylic acid amide (CHEBI:29347) |
| ohmefentanyl (CHEBI:194294) is a piperidines (CHEBI:26151) |
| ohmefentanyl (CHEBI:194294) is a tertiary amino compound (CHEBI:50996) |
| IUPAC Name |
|---|
| N-[1-(2-hydroxy-2-phenylethyl)-3-methylpiperidin-4-yl]-N-phenylpropanamide |
| Synonyms | Source |
|---|---|
| beta-hydroxy-3-methylfentanyl | DrugBank |
| N-[1-(2-hydroxy-2-phenylethyl)-3-methyl-4-piperidinyl]-N-phenylpropanamide | ChEBI |
| N-[1-(β-hydroxyphenethyl)-3-methyl-4-piperidyl]propionanilide | KEGG COMPOUND |
| OMF | ChEBI |
| β-hydroxy-3-methylfentanyl | ChEBI |
| Manual Xrefs | Databases |
|---|---|
| 56080 | ChemSpider |
| C22750 | KEGG COMPOUND |
| DB01570 | DrugBank |
| Ohmefentanyl | Wikipedia |
| Registry Numbers | Sources |
|---|---|
| CAS:78995-14-9 | KEGG COMPOUND |
| Citations |
|---|