EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C13H11NO4S |
| Net Charge | 0 |
| Average Mass | 277.301 |
| Monoisotopic Mass | 277.04088 |
| SMILES | Cc1nc(C)c(C(=O)O)c(-c2ccsc2)c1C(=O)O |
| InChI | InChI=1S/C13H11NO4S/c1-6-9(12(15)16)11(8-3-4-19-5-8)10(13(17)18)7(2)14-6/h3-5H,1-2H3,(H,15,16)(H,17,18) |
| InChIKey | DPMSHSCAQSPBKZ-UHFFFAOYSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Homo sapiens (ncbitaxon:9606) | peripheral blood mononuclear cell (BTO:0001025) | MetaboLights (MTBLS6661) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 2,6-dimethyl-4-(3-thienyl)pyridine-3,5-dicarboxylic acid (CHEBI:194290) is a aromatic carboxylic acid (CHEBI:33859) |
| 2,6-dimethyl-4-(3-thienyl)pyridine-3,5-dicarboxylic acid (CHEBI:194290) is a pyridines (CHEBI:26421) |
| IUPAC Name |
|---|
| 2,6-dimethyl-4-thiophen-3-ylpyridine-3,5-dicarboxylic acid |
| Manual Xrefs | Databases |
|---|---|
| 2021403 | ChemSpider |