EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C17H17N3O2 |
| Net Charge | 0 |
| Average Mass | 295.342 |
| Monoisotopic Mass | 295.13208 |
| SMILES | O=C(c1ccco1)N1CCN(c2cccc3nccc23)CC1 |
| InChI | InChI=1S/C17H17N3O2/c21-17(16-5-2-12-22-16)20-10-8-19(9-11-20)15-4-1-3-14-13(15)6-7-18-14/h1-7,12,18H,8-11H2 |
| InChIKey | KPGKDRAVHHIWHR-UHFFFAOYSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Homo sapiens (ncbitaxon:9606) | peripheral blood mononuclear cell (BTO:0001025) | MetaboLights (MTBLS6661) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 2-furyl[4-(1H-indol-4-yl)piperazino]methanone (CHEBI:194284) is a N-arylpiperazine (CHEBI:46848) |
| IUPAC Name |
|---|
| uran-2-yl-[4-(1H-indol-4-yl)piperazin-1-yl]methanone |
| Manual Xrefs | Databases |
|---|---|
| 2081312 | ChemSpider |