EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C16H21N3O |
| Net Charge | 0 |
| Average Mass | 271.364 |
| Monoisotopic Mass | 271.16846 |
| SMILES | [H][C@]1(c2nnc(Cc3ccccc3)o2)CCN(C(C)C)C1 |
| InChI | InChI=1S/C16H21N3O/c1-12(2)19-9-8-14(11-19)16-18-17-15(20-16)10-13-6-4-3-5-7-13/h3-7,12,14H,8-11H2,1-2H3/t14-/m0/s1 |
| InChIKey | IBVGSFOCMFNIEX-AWEZNQCLSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Homo sapiens (ncbitaxon:9606) | peripheral blood mononuclear cell (BTO:0001025) | MetaboLights (MTBLS6661) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 2-Benzyl-5-[(3S)-1-isopropyl-3-pyrrolidinyl]-1,3,4-oxadiazole (CHEBI:194276) is a aralkylamine (CHEBI:18000) |
| IUPAC Name |
|---|
| 2-benzyl-5-[(3S)-1-propan-2-ylpyrrolidin-3-yl]-1,3,4-oxadiazole |
| Manual Xrefs | Databases |
|---|---|
| 29850410 | ChemSpider |