EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C10H10O5 |
| Net Charge | 0 |
| Average Mass | 210.185 |
| Monoisotopic Mass | 210.05282 |
| SMILES | COC(=O)c1ccc(O)c(C(=O)OC)c1 |
| InChI | InChI=1S/C10H10O5/c1-14-9(12)6-3-4-8(11)7(5-6)10(13)15-2/h3-5,11H,1-2H3 |
| InChIKey | ALBUJVBOIXVVLS-UHFFFAOYSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Homo sapiens (ncbitaxon:9606) | peripheral blood mononuclear cell (BTO:0001025) | MetaboLights (MTBLS6661) |
| Roles Classification |
|---|
| Application: | endocrine disruptor Any compound that can disrupt the functions of the endocrine (hormone) system |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Dimethyl 4-hydroxyisophthalate (CHEBI:194259) is a phthalate ester (CHEBI:35484) |
| IUPAC Name |
|---|
| dimethyl 4-hydroxybenzene-1,3-dicarboxylate |
| Manual Xrefs | Databases |
|---|---|
| 72337 | ChemSpider |