EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C11H20O2 |
| Net Charge | 0 |
| Average Mass | 184.279 |
| Monoisotopic Mass | 184.14633 |
| SMILES | CC/C=C/CCOC(=O)CC(C)C |
| InChI | InChI=1S/C11H20O2/c1-4-5-6-7-8-13-11(12)9-10(2)3/h5-6,10H,4,7-9H2,1-3H3/b6-5+ |
| InChIKey | AIQLNKITFBJPFO-AATRIKPKSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Camellia sinensis (ncbitaxon:4442) | - | PubMed (31478003) |
| Roles Classification |
|---|
| Chemical Role: | flavouring agent A food additive that is used to added improve the taste or odour of a food. |
| Biological Roles: | plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. flavouring agent A food additive that is used to added improve the taste or odour of a food. |
| Application: | flavouring agent A food additive that is used to added improve the taste or odour of a food. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| trans-3-hexenyl isovalerate (CHEBI:194238) has role plant metabolite (CHEBI:76924) |
| trans-3-hexenyl isovalerate (CHEBI:194238) is a 3-hexenyl isovalerate (CHEBI:194237) |
| IUPAC Name |
|---|
| (3E)-hex-3-en-1-yl 3-methylbutanoate |
| Synonyms | Source |
|---|---|
| (3E)-3-hexenyl 3-methylbutanoate | ChEBI |
| (3E)-hex-3-enyl 3-methylbutyrate | ChEBI |
| (3E)-hex-3-enyl isovalerate | ChEBI |
| (3E)-hexenyl 3-methyl butyrate | ChEBI |
| (3E)-hexenyl isovalerate | ChEBI |
| 3-methylbutanoic acid (3E)-3-hexen-1-yl ester | ChEBI |
| Manual Xrefs | Databases |
|---|---|
| 4825609 | ChemSpider |
| Registry Numbers | Sources |
|---|---|
| Reaxys:32652697 | Reaxys |
| CAS:88296-26-8 | ChemIDplus |
| Citations |
|---|