EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C21H17O11 |
| Net Charge | -1 |
| Average Mass | 445.356 |
| Monoisotopic Mass | 445.07763 |
| SMILES | O=C1[C@@H](O)[C@H](c2c([O-])cc3oc(-c4ccc(O)c(O)c4)cc(=O)c3c2O)O[C@H](CO)[C@H]1O |
| InChI | InChI=1S/C21H18O11/c22-6-14-17(27)19(29)20(30)21(32-14)16-11(26)5-13-15(18(16)28)10(25)4-12(31-13)7-1-2-8(23)9(24)3-7/h1-5,14,17,20-24,26-28,30H,6H2/p-1/t14-,17-,20-,21+/m1/s1 |
| InChIKey | RNSACPUPPGOAKB-NVGWVTIJSA-M |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 3''-dehydroisoorientin(1−) (CHEBI:194218) is a phenolate anion (CHEBI:50525) |
| 3''-dehydroisoorientin(1−) (CHEBI:194218) is conjugate acid of 3''-oxohomoorientin(2−) (CHEBI:229565) |
| Incoming Relation(s) |
| 3''-oxohomoorientin(2−) (CHEBI:229565) is conjugate base of 3''-dehydroisoorientin(1−) (CHEBI:194218) |
| UniProt Name | Source |
|---|---|
| 3''-dehydroisoorientin | UniProt |
| Citations |
|---|