EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C46H74N14O15 |
| Net Charge | 0 |
| Average Mass | 1063.181 |
| Monoisotopic Mass | 1062.54581 |
| SMILES | CC(C)[C@H](NC(=O)[C@H](CC(=O)O)NC(=O)[C@@H]1CCCN1C(=O)CNC(=O)[C@H](C)NC(=O)[C@@H]1CCCN1C(=O)[C@@H]1CCCN1C(=O)[C@@H](N)[C@@H](C)O)C(=O)NCC(=O)N1CCC[C@H]1C(=O)N[C@@H](CCCNC(=N)N)C(=O)O |
| InChI | InChI=1S/C46H74N14O15/c1-23(2)36(42(71)52-22-33(63)57-16-6-11-28(57)40(69)54-26(45(74)75)10-5-15-50-46(48)49)56-38(67)27(20-34(64)65)55-41(70)29-12-7-17-58(29)32(62)21-51-37(66)24(3)53-39(68)30-13-8-18-59(30)43(72)31-14-9-19-60(31)44(73)35(47)25(4)61/h23-31,35-36,61H,5-22,47H2,1-4H3,(H,51,66)(H,52,71)(H,53,68)(H,54,69)(H,55,70)(H,56,67)(H,64,65)(H,74,75)(H4,48,49,50)/t24-,25+,26-,27-,28-,29-,30-,31-,35-,36-/m0/s1 |
| InChIKey | MGUYOORQEGDWEH-WDZUUAOZSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Agkistrodon bilineatus (ncbitaxon:8718) | venom (BTO:0001439) | PubMed (16277978) | |
| Crotalus viridis viridis (ncbitaxon:8742) | venom (BTO:0001439) | PubMed (16277978) | |
| Lachesis muta (ncbitaxon:8752) | venom (BTO:0001439) | PubMed (16277978) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Biological Roles: | animal metabolite Any eukaryotic metabolite produced during a metabolic reaction in animals that include diverse creatures from sponges, insects to mammals. bradykinin receptor antagonist An antagonist at the bradykinin receptor. venom A toxin used by animals and injected into their victims by a bite or sting. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Thr-Pro-Pro-Ala-Gly-Pro-Asp-Val-Gly-Pro-Arg (CHEBI:194213) has role animal metabolite (CHEBI:75767) |
| Thr-Pro-Pro-Ala-Gly-Pro-Asp-Val-Gly-Pro-Arg (CHEBI:194213) has role bradykinin receptor antagonist (CHEBI:68557) |
| Thr-Pro-Pro-Ala-Gly-Pro-Asp-Val-Gly-Pro-Arg (CHEBI:194213) has role venom (CHEBI:78505) |
| Thr-Pro-Pro-Ala-Gly-Pro-Asp-Val-Gly-Pro-Arg (CHEBI:194213) is a oligopeptide (CHEBI:25676) |
| IUPAC Name |
|---|
| L-threonyl-L-prolyl-L-prolyl-L-alanylglycyl-L-prolyl-L-α-aspartyl-L-valylglycyl-L-prolyl-L-arginine |
| Synonyms | Source |
|---|---|
| H-Thr-Pro-Pro-Ala-Gly-Pro-Asp-Val-Gly-Pro-Arg-OH | ChEBI |
| L-Thr-L-Pro-L-Pro-L-Ala-Gly-L-Pro-L-Asp-L-Val-Gly-L-Pro-L-Arg | ChEBI |
| Thr-Pro-Pro-Ala-Gly-Pro-Asp-Val-Gly-Pro-Arg-OH | ChEBI |
| T-P-P-A-G-P-D-V-G-P-R | ChEBI |
| TPPAGPDVGPR | ChEBI |
| Registry Numbers | Sources |
|---|---|
| CAS:873083-34-2 | ChEBI |
| Citations |
|---|