EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C20H34O |
| Net Charge | 0 |
| Average Mass | 290.491 |
| Monoisotopic Mass | 290.26097 |
| SMILES | [H][C@@]12C[C@]1(C)[C@H](O)C[C@]1(C)CC[C@@]3(C)CC[C@H](C(C)C)[C@]3([H])[C@]12[H] |
| InChI | InChI=1S/C20H34O/c1-12(2)13-6-7-18(3)8-9-19(4)11-15(21)20(5)10-14(20)17(19)16(13)18/h12-17,21H,6-11H2,1-5H3/t13-,14+,15-,16-,17-,18-,19+,20+/m1/s1 |
| InChIKey | JXDKJHNZVVRXON-QOFRVKGVSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Fossombronia alaskana (ncbitaxon:464312) | - | DOI (10.1016/S0031-9422(96)00781-9) | |
| Lepicolea ochroleuca (ncbitaxon:255962) | whole plant (BTO:0001461) | PubMed (10820790) | |
| Pleurozia subinflata (ncbitaxon:255982) | - | PubMed (32062804) |
| Roles Classification |
|---|
| Biological Role: | plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 13-epi-neoverrucosan-5β-ol (CHEBI:194212) has role plant metabolite (CHEBI:76924) |
| 13-epi-neoverrucosan-5β-ol (CHEBI:194212) is a carbotetracyclic compound (CHEBI:177332) |
| 13-epi-neoverrucosan-5β-ol (CHEBI:194212) is a diterpenoid (CHEBI:23849) |
| 13-epi-neoverrucosan-5β-ol (CHEBI:194212) is a organic hydroxy compound (CHEBI:33822) |
| IUPAC Name |
|---|
| (1aS,2R,3aS,5aR,8R,8aR,8bR,8cS)-1a,3a,5a-trimethyl-8-(propan-2-yl)tetradecahydrocyclopenta[a]cyclopropa[h]naphthalen-2-ol |
| Synonym | Source |
|---|---|
| 5β-hydroxy-epi-neoverrucosane | ChEBI |
| Citations |
|---|