EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C22H25NO2 |
| Net Charge | 0 |
| Average Mass | 335.447 |
| Monoisotopic Mass | 335.18853 |
| SMILES | CCCCCn1cc(C(=O)Cc2ccc(OC)cc2)c2ccccc21 |
| InChI | InChI=1S/C22H25NO2/c1-3-4-7-14-23-16-20(19-8-5-6-9-21(19)23)22(24)15-17-10-12-18(25-2)13-11-17/h5-6,8-13,16H,3-4,7,14-15H2,1-2H3 |
| InChIKey | KQRKUKYSZPHOKC-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Biological Roles: | cannabinoid receptor agonist An agonist that binds to and activates cannabinoid receptors. cannabinoid receptor agonist An agonist that binds to and activates cannabinoid receptors. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| JWH-201 (CHEBI:194211) has role cannabinoid receptor agonist (CHEBI:67072) |
| JWH-201 (CHEBI:194211) is a aromatic ketone (CHEBI:76224) |
| JWH-201 (CHEBI:194211) is a indoles (CHEBI:24828) |
| JWH-201 (CHEBI:194211) is a monomethoxybenzene (CHEBI:25235) |
| JWH-201 (CHEBI:194211) is a synthetic cannabinoid (CHEBI:67201) |
| IUPAC Name |
|---|
| 2-(4-methoxyphenyl)-1-(1-pentyl-1H-indol-3-yl)ethanone |
| Synonyms | Source |
|---|---|
| 2-(4-methoxyphenyl)-1-(1-pentylindol-3-yl)ethanone | ChEBI |
| 2-(4-methoxyphenyl)-1-(1-pentyl-1H-indol-3-yl)-ethanone | ChEBI |
| 2-(4-methoxyphenyl)-1-(1-pentyl-1H-indol-3-yl)ethan-1-one | ChEBI |
| JWH 201 | ChEBI |
| JWH201 | ChEBI |
| Registry Numbers | Sources |
|---|---|
| CAS:864445-47-6 | PubChem Compound |
| Citations |
|---|