EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C19H35NO4 |
| Net Charge | 0 |
| Average Mass | 341.492 |
| Monoisotopic Mass | 341.25661 |
| SMILES | CCCCCC(O)CCC1CCC(=O)N1CCCCCCC(=O)O |
| InChI | InChI=1S/C19H35NO4/c1-2-3-6-9-17(21)13-11-16-12-14-18(22)20(16)15-8-5-4-7-10-19(23)24/h16-17,21H,2-15H2,1H3,(H,23,24) |
| InChIKey | CBWGHEDGUILASE-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Role: | prostaglandin receptor agonist An agonist that binds to and activates prostaglandin receptors. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 2-(3-hydroxyoctyl)-5-oxo-1-pyrrolidineheptanoic acid (CHEBI:194210) has role prostaglandin receptor agonist (CHEBI:66900) |
| 2-(3-hydroxyoctyl)-5-oxo-1-pyrrolidineheptanoic acid (CHEBI:194210) is a hydroxy monocarboxylic acid (CHEBI:35868) |
| 2-(3-hydroxyoctyl)-5-oxo-1-pyrrolidineheptanoic acid (CHEBI:194210) is a pyrrolidin-2-ones (CHEBI:74223) |
| 2-(3-hydroxyoctyl)-5-oxo-1-pyrrolidineheptanoic acid (CHEBI:194210) is a secondary alcohol (CHEBI:35681) |
| IUPAC Name |
|---|
| 7-[2-(3-hydroxyoctyl)-5-oxopyrrolidin-1-yl]heptanoic acid |
| Synonyms | Source |
|---|---|
| CAY10580 | ChEBI |
| CAY 10580 | ChEBI |
| CAY-10580 | ChEBI |
| Registry Numbers | Sources |
|---|---|
| CAS:64054-40-6 | ChEBI |
| Citations |
|---|