EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C20H32 |
| Net Charge | 0 |
| Average Mass | 272.476 |
| Monoisotopic Mass | 272.25040 |
| SMILES | [H][C@]1(C(=C)CC/C=C(\C)CCC=C(C)C)CC=C(C)CC1 |
| InChI | InChI=1S/C20H32/c1-16(2)8-6-9-17(3)10-7-11-19(5)20-14-12-18(4)13-15-20/h8,10,12,20H,5-7,9,11,13-15H2,1-4H3/b17-10+/t20-/m0/s1 |
| InChIKey | XENHETWDODOOQC-YZILGEIOSA-N |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| (R)-axinyssene (CHEBI:194194) is a diterpene (CHEBI:35190) |
| (R)-axinyssene (CHEBI:194194) is enantiomer of (S)-axinyssene (CHEBI:194195) |
| Incoming Relation(s) |
| (S)-axinyssene (CHEBI:194195) is enantiomer of (R)-axinyssene (CHEBI:194194) |
| Synonym | Source |
|---|---|
| (+)-axinyssene | MetaCyc |
| UniProt Name | Source |
|---|---|
| (R)-axinyssene | UniProt |
| Manual Xrefs | Databases |
|---|---|
| CPD-26034 | MetaCyc |
| Citations |
|---|