EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C20H32 |
| Net Charge | 0 |
| Average Mass | 272.476 |
| Monoisotopic Mass | 272.25040 |
| SMILES | CC1=CC[C@]2(C)CC[C@@]3(C)CCC(C)(C)CC3=C2CC1 |
| InChI | InChI=1S/C20H32/c1-15-6-7-16-17-14-18(2,3)10-11-20(17,5)13-12-19(16,4)9-8-15/h8H,6-7,9-14H2,1-5H3/t19-,20-/m1/s1 |
| InChIKey | YOIRRAMAGAXTPB-WOJBJXKFSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Streptomyces lydicus (ncbitaxon:47763) | - | PubMed (28371074) | Produced by the large-scale culturing of E. coli BW25113 expressing StlTC gene from Streptomyces lydicus. |
| Roles Classification |
|---|
| Biological Role: | bacterial metabolite Any prokaryotic metabolite produced during a metabolic reaction in bacteria. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| lydicene (CHEBI:194193) has role bacterial metabolite (CHEBI:76969) |
| lydicene (CHEBI:194193) is a carbotricyclic compound (CHEBI:38032) |
| lydicene (CHEBI:194193) is a diterpene (CHEBI:35190) |
| IUPAC Name |
|---|
| (4aR,6aS)-2,2,4a,6a,9-pentamethyl-2,3,4,4a,5,6,6a,7,10,11-decahydro-1H-cyclohepta[a]naphthalene |
| UniProt Name | Source |
|---|---|
| lydicene | UniProt |
| Manual Xrefs | Databases |
|---|---|
| CPD-26033 | MetaCyc |
| Citations |
|---|