EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C20H34O |
| Net Charge | 0 |
| Average Mass | 290.491 |
| Monoisotopic Mass | 290.26097 |
| SMILES | [H][C@@]12C[C@]1(C)[C@H](O)C[C@]1(C)CC[C@@]3(C)CC[C@@H](C(C)C)[C@]3([H])[C@]12[H] |
| InChI | InChI=1S/C20H34O/c1-12(2)13-6-7-18(3)8-9-19(4)11-15(21)20(5)10-14(20)17(19)16(13)18/h12-17,21H,6-11H2,1-5H3/t13-,14-,15+,16+,17+,18+,19-,20-/m0/s1 |
| InChIKey | JXDKJHNZVVRXON-ROJCJYFNSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Axinyssa aplysionides (ncbitaxon:237151) | - | PubMed (7760073) | |
| Mylia verrucosa (ncbitaxon:537837) | - | DOI (10.1039/C39800000822) | |
| Scapania bolanderi (ncbitaxon:537845) | whole plant (BTO:0001461) | DOI (10.1515/znb-1984-0923) |
| Roles Classification |
|---|
| Biological Roles: | plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. animal metabolite Any eukaryotic metabolite produced during a metabolic reaction in animals that include diverse creatures from sponges, insects to mammals. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| neoverrucosan-5β-ol (CHEBI:194191) has role animal metabolite (CHEBI:75767) |
| neoverrucosan-5β-ol (CHEBI:194191) has role plant metabolite (CHEBI:76924) |
| neoverrucosan-5β-ol (CHEBI:194191) is a carbotetracyclic compound (CHEBI:177332) |
| neoverrucosan-5β-ol (CHEBI:194191) is a diterpenoid (CHEBI:23849) |
| neoverrucosan-5β-ol (CHEBI:194191) is a organic hydroxy compound (CHEBI:33822) |
| IUPAC Name |
|---|
| (1aS,2R,3aS,5aR,8S,8aR,8bR,8cS)-1a,3a,5a-trimethyl-8-(propan-2-yl)tetradecahydrocyclopenta[a]cyclopropa[h]naphthalen-2-ol |
| Synonyms | Source |
|---|---|
| (−)-5β-hydroxyneoverrucosane | ChEBI |
| (−)-neoverrucosan-5β-ol | ChEBI |
| UniProt Name | Source |
|---|---|
| neoverrucosan-5β-ol | UniProt |
| Manual Xrefs | Databases |
|---|---|
| CPD-26032 | MetaCyc |
| Registry Numbers | Sources |
|---|---|
| CAS:76235-09-1 | ChEBI |
| Citations |
|---|