EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C9H8Cl2O3 |
| Net Charge | 0 |
| Average Mass | 235.066 |
| Monoisotopic Mass | 233.98505 |
| SMILES | COC(=O)c1c(Cl)ccc(Cl)c1OC |
| InChI | InChI=1S/C9H8Cl2O3/c1-13-8-6(11)4-3-5(10)7(8)9(12)14-2/h3-4H,1-2H3 |
| InChIKey | AWSBKDYHGOOSML-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Chemical Role: | environmental contaminant Any minor or unwanted substance introduced into the environment that can have undesired effects. |
| Biological Role: | synthetic auxin A synthetic compound exhibiting auxin activity. |
| Applications: | agrochemical An agrochemical is a substance that is used in agriculture or horticulture. herbicide A substance used to destroy plant pests. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| dicamba-methyl (CHEBI:194161) has functional parent dicamba (CHEBI:81856) |
| dicamba-methyl (CHEBI:194161) has role agrochemical (CHEBI:33286) |
| dicamba-methyl (CHEBI:194161) has role environmental contaminant (CHEBI:78298) |
| dicamba-methyl (CHEBI:194161) has role herbicide (CHEBI:24527) |
| dicamba-methyl (CHEBI:194161) has role synthetic auxin (CHEBI:26841) |
| dicamba-methyl (CHEBI:194161) is a dichlorobenzene (CHEBI:23697) |
| dicamba-methyl (CHEBI:194161) is a methyl ester (CHEBI:25248) |
| dicamba-methyl (CHEBI:194161) is a monomethoxybenzene (CHEBI:25235) |
| IUPAC Name |
|---|
| methyl 3,6-dichloro-2-methoxybenzoate |
| Synonyms | Source |
|---|---|
| 2-methoxy-3,6-dichlorobenzoic acid methyl ester | NIST Chemistry WebBook |
| 3,6-dichloro-2-methoxybenzoic acid methyl ester | ChEBI |
| dicamba methyl | ChEBI |
| dicamba methyl ester | ChEBI |
| disugran | Alan Wood's Pesticides |
| methyl 2-methoxy-3,6-dichlorobenzoate | NIST Chemistry WebBook |
| Brand Names | Source |
|---|---|
| Racusa | NIST Chemistry WebBook |
| Racuza | NIST Chemistry WebBook |
| Manual Xrefs | Databases |
|---|---|
| 3370 | PPDB |
| 73143 | ChemSpider |
| derivatives/dicamba-methyl | Alan Wood's Pesticides |
| Registry Numbers | Sources |
|---|---|
| CAS:6597-78-0 | Alan Wood's Pesticides |
| CAS:6597-78-0 | NIST Chemistry WebBook |
| Citations |
|---|