EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C2H7NO.C8H6Cl2O3 |
| Net Charge | 0 |
| Average Mass | 282.123 |
| Monoisotopic Mass | 281.02216 |
| SMILES | COc1c(Cl)ccc(Cl)c1C(=O)O.NCCO |
| InChI | InChI=1S/C8H6Cl2O3.C2H7NO/c1-13-7-5(10)3-2-4(9)6(7)8(11)12;3-1-2-4/h2-3H,1H3,(H,11,12);4H,1-3H2 |
| InChIKey | PYJWLFDSOCOIHD-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Applications: | agrochemical An agrochemical is a substance that is used in agriculture or horticulture. herbicide A substance used to destroy plant pests. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| dicamba-olamine (CHEBI:194160) has part 3,6-dichloro-2-methoxybenzoate (CHEBI:141349) |
| dicamba-olamine (CHEBI:194160) has role agrochemical (CHEBI:33286) |
| dicamba-olamine (CHEBI:194160) has role herbicide (CHEBI:24527) |
| dicamba-olamine (CHEBI:194160) is a organoammonium salt (CHEBI:46850) |
| IUPAC Name |
|---|
| 3,6-dichloro-2-methoxybenzoic acid - 2-aminoethanol |
| Synonyms | Source |
|---|---|
| 3,6-dichloro-2-methoxybenzoic acid - 2-aminoethanol (1:1) | ChEBI |
| 3,6-dichloro-2-methoxybenzoic acid—2-aminoethan-1-ol (1/1) | Alan Wood's Pesticides |
| 3,6-dichloro-o-anisic acid - 2-aminoethanol | ChEBI |
| 3,6-dichloro-o-anisic acid - 2-aminoethanol (1:1) | Alan Wood's Pesticides |
| (2-hydroxyethyl)ammonium 3,6-dichloro-2-methoxybenzoate | Alan Wood's Pesticides |
| 3,6-dichloro-2-methoxybenzoic acid compound with 2-aminoethanol (1:1) | Alan Wood's Pesticides |
| Manual Xrefs | Databases |
|---|---|
| derivatives/dicamba-olamine | Alan Wood's Pesticides |
| 55879 | ChemSpider |
| 3371 | PPDB |
| Registry Numbers | Sources |
|---|---|
| CAS:53404-28-7 | Alan Wood's Pesticides |