EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C8H5Cl2O3.K |
| Net Charge | 0 |
| Average Mass | 259.129 |
| Monoisotopic Mass | 257.92528 |
| SMILES | COc1c(Cl)ccc(Cl)c1C(=O)[O-].[K+] |
| InChI | InChI=1S/C8H6Cl2O3.K/c1-13-7-5(10)3-2-4(9)6(7)8(11)12;/h2-3H,1H3,(H,11,12);/q;+1/p-1 |
| InChIKey | RVJMEWSAFHIEJX-UHFFFAOYSA-M |
| Roles Classification |
|---|
| Applications: | agrochemical An agrochemical is a substance that is used in agriculture or horticulture. herbicide A substance used to destroy plant pests. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| dicamba-potassium (CHEBI:194159) has part 3,6-dichloro-2-methoxybenzoate (CHEBI:141349) |
| dicamba-potassium (CHEBI:194159) has role agrochemical (CHEBI:33286) |
| dicamba-potassium (CHEBI:194159) has role herbicide (CHEBI:24527) |
| dicamba-potassium (CHEBI:194159) is a organic potassium salt (CHEBI:50394) |
| IUPAC Name |
|---|
| potassium 3,6-dichloro-2-methoxybenzoate |
| Synonyms | Source |
|---|---|
| 2-methoxy-3,6-dichlorobenzoic acid potassium salt | ChEBI |
| dicamba potassium | ChEBI |
| dicamba potassium salt | ChEBI |
| potassium 2-methoxy-3,6-dichlorobenzoate | ChEBI |
| potassium 3,6-dichloro-o-anisate | Alan Wood's Pesticides |
| potassium dicamba | ChEBI |
| Manual Xrefs | Databases |
|---|---|
| 3372 | PPDB |
| 74259 | ChemSpider |
| derivatives/dicamba-potassium | Alan Wood's Pesticides |
| Registry Numbers | Sources |
|---|---|
| CAS:10007-85-9 | Alan Wood's Pesticides |