EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C8H5Cl2O3.Na |
| Net Charge | 0 |
| Average Mass | 243.021 |
| Monoisotopic Mass | 241.95134 |
| SMILES | COc1c(Cl)ccc(Cl)c1C(=O)[O-].[Na+] |
| InChI | InChI=1S/C8H6Cl2O3.Na/c1-13-7-5(10)3-2-4(9)6(7)8(11)12;/h2-3H,1H3,(H,11,12);/q;+1/p-1 |
| InChIKey | HLZCHRAMVPCKDU-UHFFFAOYSA-M |
| Roles Classification |
|---|
| Applications: | agrochemical An agrochemical is a substance that is used in agriculture or horticulture. herbicide A substance used to destroy plant pests. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| dicamba-sodium (CHEBI:194158) has part 3,6-dichloro-2-methoxybenzoate (CHEBI:141349) |
| dicamba-sodium (CHEBI:194158) has role agrochemical (CHEBI:33286) |
| dicamba-sodium (CHEBI:194158) has role herbicide (CHEBI:24527) |
| dicamba-sodium (CHEBI:194158) is a organic sodium salt (CHEBI:38700) |
| IUPAC Name |
|---|
| sodium 3,6-dichloro-2-methoxybenzoate |
| Synonyms | Source |
|---|---|
| 2-methoxy-3,6-dichlorobenzoic acid sodium salt | ChEBI |
| dicamba sodium | ChEBI |
| dicamba sodium salt | ChEBI |
| sodium 2-methoxy-3,6-dichlorobenzoate | ChEBI |
| sodium 3,6-dichloro-o-anisate | Alan Wood's Pesticides |
| sodium dicamba | ChEBI |
| Manual Xrefs | Databases |
|---|---|
| 15303 | ChemSpider |
| 3373 | PPDB |
| /derivatives/dicamba-sodium | Alan Wood's Pesticides |
| Registry Numbers | Sources |
|---|---|
| CAS:1982-69-0 | Alan Wood's Pesticides |
| Citations |
|---|