EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C15H24 |
| Net Charge | 0 |
| Average Mass | 204.357 |
| Monoisotopic Mass | 204.18780 |
| SMILES | CC(C)C1=CC2=C(CC[C@@H]2C)[C@@H](C)CC1 |
| InChI | InChI=1S/C15H24/c1-10(2)13-7-5-11(3)14-8-6-12(4)15(14)9-13/h9-12H,5-8H2,1-4H3/t11-,12-/m0/s1 |
| InChIKey | YLPOFTFBOIPYLE-RYUDHWBXSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Spiromastix sp. (ncbitaxon:2044277) | - | PubMed (36414326) |
| Roles Classification |
|---|
| Biological Roles: | fungal metabolite Any eukaryotic metabolite produced during a metabolic reaction in fungi, the kingdom that includes microorganisms such as the yeasts and moulds. marine metabolite Any metabolite produced during a metabolic reaction in marine macro- and microorganisms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| guaia-1(5),6-diene (CHEBI:194155) has role fungal metabolite (CHEBI:76946) |
| guaia-1(5),6-diene (CHEBI:194155) has role marine metabolite (CHEBI:76507) |
| guaia-1(5),6-diene (CHEBI:194155) is a carbobicyclic compound (CHEBI:36785) |
| guaia-1(5),6-diene (CHEBI:194155) is a sesquiterpene (CHEBI:35189) |
| IUPAC Name |
|---|
| (1S,4S)-1,4-dimethyl-7-(propan-2-yl)-1,2,3,4,5,6-hexahydroazulene |
| Citations |
|---|