EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C27H28N2O4 |
| Net Charge | 0 |
| Average Mass | 444.531 |
| Monoisotopic Mass | 444.20491 |
| SMILES | CC(=O)OC[C@H](Cc1ccccc1)NC(=O)C(Cc1ccccc1)NC(=O)c1ccccc1 |
| InChI | InChI=1S/C27H28N2O4/c1-20(30)33-19-24(17-21-11-5-2-6-12-21)28-27(32)25(18-22-13-7-3-8-14-22)29-26(31)23-15-9-4-10-16-23/h2-16,24-25H,17-19H2,1H3,(H,28,32)(H,29,31)/t24-,25?/m0/s1 |
| InChIKey | VZPAURMDJZOGHU-SKCDSABHSA-N |
| Roles Classification |
|---|
| Chemical Roles: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Application: | central nervous system stimulant Any drug that enhances the activity of the central nervous system. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| aurantiamide acetate (CHEBI:194125) is a amphetamines (CHEBI:35338) |
| IUPAC Name |
|---|
| [(2S)-2-[(2-benzamido-3-phenylpropanoyl)amino]-3-phenylpropyl] acetate |
| Registry Numbers | Sources |
|---|---|
| CAS:56121-42-7 | SUBMITTER |