EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C8H6N2O7 |
| Net Charge | 0 |
| Average Mass | 242.143 |
| Monoisotopic Mass | 242.01750 |
| SMILES | O=C(O)Cc1cc([N+](=O)[O-])c(O)c([N+](=O)[O-])c1 |
| InChI | InChI=1S/C8H6N2O7/c11-7(12)3-4-1-5(9(14)15)8(13)6(2-4)10(16)17/h1-2,13H,3H2,(H,11,12) |
| InChIKey | MLVYQQLUGFSXQH-UHFFFAOYSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Salegentibacter sp. T436 (ncbitaxon:1729720) | - | PubMed (17551208) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Roles: | bacterial metabolite Any prokaryotic metabolite produced during a metabolic reaction in bacteria. hapten Any substance capable of eliciting an immune response only when attached to a large carrier such as a protein. Examples include dinitrophenols; oligosaccharides; peptides; and heavy metals. marine metabolite Any metabolite produced during a metabolic reaction in marine macro- and microorganisms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| (4-hydroxy-3,5-dinitrophenyl)acetic acid (CHEBI:194097) has role bacterial metabolite (CHEBI:76969) |
| (4-hydroxy-3,5-dinitrophenyl)acetic acid (CHEBI:194097) has role hapten (CHEBI:59174) |
| (4-hydroxy-3,5-dinitrophenyl)acetic acid (CHEBI:194097) has role marine metabolite (CHEBI:76507) |
| (4-hydroxy-3,5-dinitrophenyl)acetic acid (CHEBI:194097) is a dinitrophenol (CHEBI:39352) |
| (4-hydroxy-3,5-dinitrophenyl)acetic acid (CHEBI:194097) is a phenylacetic acids (CHEBI:25978) |
| IUPAC Name |
|---|
| (4-hydroxy-3,5-dinitrophenyl)acetic acid |
| Synonyms | Source |
|---|---|
| 4-hydroxy-3,5-dinitrobenzeneacetic acid | ChemIDplus |
| 2-(4-hydroxy-3,5-dinitrophenyl)acetic acid | ChEBI |
| 4-hydroxy-3,5-dinitrophenylacetic acid | ChEBI |
| 3,5-dinitro-4-hydroxyphenacetic acid | ChEBI |
| 3,5-dinitro-4-hydroxyphenylacetic acid | ChEBI |
| Registry Numbers | Sources |
|---|---|
| CAS:10463-37-3 | ChemIDplus |
| Citations |
|---|