EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C15H17N4O5 |
| Net Charge | -1 |
| Average Mass | 333.324 |
| Monoisotopic Mass | 333.12044 |
| SMILES | [H][C@]12N[C@@]1([H])CN1C3=C(C(=O)C(N)=C(C)C3=O)[C-](COC(N)=O)[C@]12OC |
| InChI | InChI=1S/C15H17N4O5/c1-5-9(16)12(21)8-6(4-24-14(17)22)15(23-2)13-7(18-13)3-19(15)10(8)11(5)20/h7,13,18H,3-4,16H2,1-2H3,(H2,17,22)/q-1/t7-,13-,15+/m0/s1 |
| InChIKey | TWSVZLVCDAGJHJ-QWPQFENESA-N |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| mitomycin C(1−) (CHEBI:194095) is a organic molecular entity (CHEBI:50860) |
| mitomycin C(1−) (CHEBI:194095) is conjugate base of mitomycin C (CHEBI:27504) |
| Incoming Relation(s) |
| mitomycin C (CHEBI:27504) is conjugate acid of mitomycin C(1−) (CHEBI:194095) |
| UniProt Name | Source |
|---|---|
| mitomycin C | UniProt |
| Citations |
|---|