EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C30H55N3O3 |
| Net Charge | +2 |
| Average Mass | 505.788 |
| Monoisotopic Mass | 505.42325 |
| SMILES | [H][C@@]1(C(=O)OC2CC3(C)OC4(C)C([NH2+]CCCCC[NH+](C)C)C3CC23C(C)CCC43)CCC(C)(C)CN1 |
| InChI | InChI=1S/C30H53N3O3/c1-20-11-12-23-29(5)25(31-15-9-8-10-16-33(6)7)21-17-30(20,23)24(18-28(21,4)36-29)35-26(34)22-13-14-27(2,3)19-32-22/h20-25,31-32H,8-19H2,1-7H3/p+2/t20?,21?,22-,23?,24?,25?,28?,29?,30?/m0/s1 |
| InChIKey | ANNRITYMAUJQPW-OFBHBXPESA-P |
| Roles Classification |
|---|
| Chemical Role: | polar aprotic solvent A solvent with a comparatively high relative permittivity (or dielectric constant), greater than ca. 15, and a sizable permanent dipole moment, that cannot donate suitably labile hydrogen atoms to form strong hydrogen bonds. |
| Application: | polar aprotic solvent A solvent with a comparatively high relative permittivity (or dielectric constant), greater than ca. 15, and a sizable permanent dipole moment, that cannot donate suitably labile hydrogen atoms to form strong hydrogen bonds. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| flavunoidine(2+) (CHEBI:194091) is a oxolane (CHEBI:26911) |
| UniProt Name | Source |
|---|---|
| flavunoidine | UniProt |
| Citations |
|---|