EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C13H8Cl2N4S2 |
| Net Charge | 0 |
| Average Mass | 355.275 |
| Monoisotopic Mass | 353.95674 |
| SMILES | Clc1cccc(Cl)c1CSc1nnc(-c2cnccn2)s1 |
| InChI | InChI=1S/C13H8Cl2N4S2/c14-9-2-1-3-10(15)8(9)7-20-13-19-18-12(21-13)11-6-16-4-5-17-11/h1-6H,7H2 |
| InChIKey | BQNXBSYSQXSXPT-UHFFFAOYSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Biological Roles: | piezo1 agonist An agonist that binds to and activates piezo1 receptors. glycine transporter 2 inhibitor Any glycine transporter inhibitor that interferes with the action of glycine 2 transporters. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| yoda 1 (CHEBI:194079) has role glycine transporter 2 inhibitor (CHEBI:85424) |
| yoda 1 (CHEBI:194079) has role piezo1 agonist (CHEBI:194154) |
| yoda 1 (CHEBI:194079) is a aromatic compound (CHEBI:33655) |
| yoda 1 (CHEBI:194079) is a dichlorobenzene (CHEBI:23697) |
| yoda 1 (CHEBI:194079) is a organic sulfide (CHEBI:16385) |
| yoda 1 (CHEBI:194079) is a pyrazines (CHEBI:38314) |
| yoda 1 (CHEBI:194079) is a thiadiazoles (CHEBI:38099) |
| IUPAC Name |
|---|
| 2-{5-[(2,6-dichlorobenzyl)sulfanyl]-1,3,4-thiadiazol-2-yl}pyrazine |
| Synonyms | Source |
|---|---|
| 2-(5-{[(2,6-dichlorophenyl)methyl]sulfanyl}-1,3,4-thiadiazol-2-yl)pyrazine | IUPAC |
| 2-[5-[[(2,6-dichlorophenyl)methyl]thio]-1,3,4-thiadiazol-2-yl]-pyrazine | ChEBI |
| yoda-1 | ChEBI |
| yoda1 | ChEBI |
| 2-[5-[[(2,6-dichlorophenyl)methyl]thio]-1,3,4-thiadiazol-2-yl]pyrazine | ChEBI |
| 2-((2,6-dichlorobenzyl)thio)-5-(pyrazin-2-yl)-1,3,4-thiadiazole | ChemIDplus |
| Manual Xrefs | Databases |
|---|---|
| Yoda1 | Wikipedia |
| Registry Numbers | Sources |
|---|---|
| CAS:448947-81-7 | ChemIDplus |
| Citations |
|---|