EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C5H8O3 |
| Net Charge | 0 |
| Average Mass | 116.116 |
| Monoisotopic Mass | 116.04734 |
| SMILES | CC1(C)OC1C(=O)O |
| InChI | InChI=1S/C5H8O3/c1-5(2)3(8-5)4(6)7/h3H,1-2H3,(H,6,7) |
| InChIKey | XAFLWKZCTIXPPU-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| dimethyloxirane-2-carboxylic acid (CHEBI:194029) is a carboxylic acid (CHEBI:33575) |
| dimethyloxirane-2-carboxylic acid (CHEBI:194029) is a epoxide (CHEBI:32955) |
| IUPAC Name |
|---|
| 3,3-dimethyloxirane-2-carboxylic acid |