EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C10H12O6 |
| Net Charge | 0 |
| Average Mass | 228.200 |
| Monoisotopic Mass | 228.06339 |
| SMILES | COc1cc(C(=O)O)c(O)c(OC)c1OC |
| InChI | InChI=1S/C10H12O6/c1-14-6-4-5(10(12)13)7(11)9(16-3)8(6)15-2/h4,11H,1-3H3,(H,12,13) |
| InChIKey | MJZXQRQWAWCETQ-UHFFFAOYSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| synthetic microbial community (ncbitaxon:3229850) | Whole Organism (NCIT:C13413) | MetaboLights (MTBLS3129) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 2-hydroxy-3,4,5-trimethoxybenzoic acid (CHEBI:194012) is a methoxybenzoic acid (CHEBI:25238) |
| IUPAC Name |
|---|
| 2-hydroxy-3,4,5-trimethoxybenzoic acid |
| Manual Xrefs | Databases |
|---|---|
| 255670 | ChemSpider |