EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
CHEBI:193995 - 3-hydroxy-2,4-dimethoxybenzoic acid
| Formula | C9H10O5 |
| Net Charge | 0 |
| Average Mass | 198.174 |
| Monoisotopic Mass | 198.05282 |
| SMILES | COc1ccc(C(=O)O)c(OC)c1O |
| InChI | InChI=1S/C9H10O5/c1-13-6-4-3-5(9(11)12)8(14-2)7(6)10/h3-4,10H,1-2H3,(H,11,12) |
| InChIKey | HEAPXXAMKQWXSS-UHFFFAOYSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| synthetic microbial community (ncbitaxon:3229850) | Whole Organism (NCIT:C13413) | MetaboLights (MTBLS3129) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 3-hydroxy-2,4-dimethoxybenzoic acid (CHEBI:193995) is a methoxybenzoic acid (CHEBI:25238) |
| IUPAC Name |
|---|
| 3-hydroxy-2,4-dimethoxybenzoic acid |
| Manual Xrefs | Databases |
|---|---|
| 15144450 | ChemSpider |