EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C10H10O4 |
| Net Charge | 0 |
| Average Mass | 194.186 |
| Monoisotopic Mass | 194.05791 |
| SMILES | COc1ccc(CC(=O)C(=O)O)cc1 |
| InChI | InChI=1S/C10H10O4/c1-14-8-4-2-7(3-5-8)6-9(11)10(12)13/h2-5H,6H2,1H3,(H,12,13) |
| InChIKey | AOPNPZIOVIPWMF-UHFFFAOYSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| synthetic microbial community (ncbitaxon:3229850) | Whole Organism (NCIT:C13413) | MetaboLights (MTBLS3129) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 3-(4-methoxyphenyl)-2-oxopropanoic acid (CHEBI:193985) has functional parent pyruvic acid (CHEBI:32816) |
| 3-(4-methoxyphenyl)-2-oxopropanoic acid (CHEBI:193985) is a 2-oxo monocarboxylic acid (CHEBI:35910) |
| IUPAC Name |
|---|
| 3-(4-methoxyphenyl)-2-oxopropanoic acid |
| Manual Xrefs | Databases |
|---|---|
| 502838 | ChemSpider |