EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C10H10O3 |
| Net Charge | 0 |
| Average Mass | 178.187 |
| Monoisotopic Mass | 178.06299 |
| SMILES | CC1(C(=O)O)OC1c1ccccc1 |
| InChI | InChI=1S/C10H10O3/c1-10(9(11)12)8(13-10)7-5-3-2-4-6-7/h2-6,8H,1H3,(H,11,12) |
| InChIKey | UPEAOFCHTFWNFG-UHFFFAOYSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| synthetic microbial community (ncbitaxon:3229850) | Whole Organism (NCIT:C13413) | MetaboLights (MTBLS3129) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 2-methyl-3-phenyloxirane-2-carboxylic acid (CHEBI:193975) is a carboxylic acid (CHEBI:33575) |
| 2-methyl-3-phenyloxirane-2-carboxylic acid (CHEBI:193975) is a epoxide (CHEBI:32955) |
| IUPAC Name |
|---|
| 2-methyl-3-phenyloxirane-2-carboxylic acid |
| Manual Xrefs | Databases |
|---|---|
| 361768 | ChemSpider |
| Registry Numbers | Sources |
|---|---|
| CAS:25547-51-7 | ChemIDplus |