EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C10H10O3 |
| Net Charge | 0 |
| Average Mass | 178.187 |
| Monoisotopic Mass | 178.06299 |
| SMILES | c1coc(COCc2ccco2)c1 |
| InChI | InChI=1S/C10H10O3/c1-3-9(12-5-1)7-11-8-10-4-2-6-13-10/h1-6H,7-8H2 |
| InChIKey | YEQMNLGBLPBBNI-UHFFFAOYSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| synthetic microbial community (ncbitaxon:3229850) | Whole Organism (NCIT:C13413) | MetaboLights (MTBLS3129) | |
| Vigna subterranea (ncbitaxon:115715) | - | PubMed (33889778) |
| Roles Classification |
|---|
| Biological Roles: | bacterial xenobiotic metabolite Any bacterial metabolite produced by metabolism of a xenobiotic compound in bacteria. plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. flavouring agent A food additive that is used to added improve the taste or odour of a food. |
| Application: | flavouring agent A food additive that is used to added improve the taste or odour of a food. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| difurfuryl ether (CHEBI:193974) has role bacterial xenobiotic metabolite (CHEBI:76976) |
| difurfuryl ether (CHEBI:193974) has role flavouring agent (CHEBI:35617) |
| difurfuryl ether (CHEBI:193974) has role plant metabolite (CHEBI:76924) |
| difurfuryl ether (CHEBI:193974) is a ether (CHEBI:25698) |
| difurfuryl ether (CHEBI:193974) is a furans (CHEBI:24129) |
| IUPAC Name |
|---|
| 2,2'-(oxydimethanediyl)difuran |
| Synonyms | Source |
|---|---|
| 2-(furan-2-ylmethoxymethyl)furan | SUBMITTER |
| 2,2'-[oxybis(methylene)]difuran | IUPAC |
| di-α-furfuryl ether | ChEBI |
| furfuryl ether | ChEBI |
| 2,2'-[oxybis(methylene)]bis[furan] | ChEBI |
| 2,2'-difurfuryl ether | ChEBI |
| Manual Xrefs | Databases |
|---|---|
| HMDB0033248 | HMDB |
| 231033 | ChemSpider |
| FDB011267 | FooDB |
| Registry Numbers | Sources |
|---|---|
| Reaxys:156726 | Reaxys |
| CAS:4437-22-3 | ChemIDplus |
| Citations |
|---|