EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C5H5NO3 |
| Net Charge | 0 |
| Average Mass | 127.099 |
| Monoisotopic Mass | 127.02694 |
| SMILES | O=C(O)c1cc(O)cn1 |
| InChI | InChI=1S/C5H5NO3/c7-3-1-4(5(8)9)6-2-3/h1-2,6-7H,(H,8,9) |
| InChIKey | FCGOBISRCUOUQH-UHFFFAOYSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| synthetic microbial community (ncbitaxon:3229850) | Whole Organism (NCIT:C13413) | MetaboLights (MTBLS3129) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Hydroxyminaline (CHEBI:193956) is a carboxylic acid (CHEBI:33575) |
| Hydroxyminaline (CHEBI:193956) is a pyrroles (CHEBI:26455) |
| IUPAC Name |
|---|
| 4-hydroxy-1H-pyrrole-2-carboxylic acid |
| Manual Xrefs | Databases |
|---|---|
| 30777050 | ChemSpider |
| HMDB0034368 | HMDB |