EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C28H38N4O14S2 |
| Net Charge | 0 |
| Average Mass | 718.760 |
| Monoisotopic Mass | 718.18259 |
| SMILES | CCC(C)C(NC(=O)C(N)Cc1ccc(OS(=O)(=O)O)cc1)C(=O)NC(Cc1ccc(OS(=O)(=O)O)cc1)C(=O)NC(C(=O)O)C(C)O |
| InChI | InChI=1S/C28H38N4O14S2/c1-4-15(2)23(31-25(34)21(29)13-17-5-9-19(10-6-17)45-47(39,40)41)27(36)30-22(26(35)32-24(16(3)33)28(37)38)14-18-7-11-20(12-8-18)46-48(42,43)44/h5-12,15-16,21-24,33H,4,13-14,29H2,1-3H3,(H,30,36)(H,31,34)(H,32,35)(H,37,38)(H,39,40,41)(H,42,43,44) |
| InChIKey | GOHLMBHZKWPJQG-UHFFFAOYSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| synthetic microbial community (ncbitaxon:3229850) | Whole Organism (NCIT:C13413) | MetaboLights (MTBLS3129) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Phytosulfokine b (CHEBI:193935) is a peptide (CHEBI:16670) |
| IUPAC Name |
|---|
| 2-[[2-[[2-[[2-amino-3-(4-sulooxyphenyl)propanoyl]amino]-3-methylpentanoyl]amino]-3-(4-sulooxyphenyl)propanoyl]amino]-3-hydroxybutanoic acid |
| Manual Xrefs | Databases |
|---|---|
| 28583438 | ChemSpider |
| HMDB0029810 | HMDB |