EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C28H39N3O9S |
| Net Charge | 0 |
| Average Mass | 593.699 |
| Monoisotopic Mass | 593.24070 |
| SMILES | [H][C@]12CCc3c(cc(SC[C@H](NC(=O)CC[C@H](N)C(=O)O)C(=O)NCC(=O)O)c(O)c3O)[C@]1([H])CC[C@]1(C)[C@@H](O)CC[C@]21[H] |
| InChI | InChI=1S/C28H39N3O9S/c1-28-9-8-13-14(17(28)4-6-21(28)32)2-3-15-16(13)10-20(25(37)24(15)36)41-12-19(26(38)30-11-23(34)35)31-22(33)7-5-18(29)27(39)40/h10,13-14,17-19,21,32,36-37H,2-9,11-12,29H2,1H3,(H,30,38)(H,31,33)(H,34,35)(H,39,40)/t13-,14+,17-,18+,19+,21+,28+/m1/s1 |
| InChIKey | ARFSXJIGVSWGDY-AGFNSGRBSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| synthetic microbial community (ncbitaxon:3229850) | Whole Organism (NCIT:C13413) | MetaboLights (MTBLS3129) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 4-Hydroxy-17beta-estradiol-2-S-glutathione (CHEBI:193919) is a peptide (CHEBI:16670) |
| IUPAC Name |
|---|
| (2S)-2-amino-5-[[(2R)-1-(carboxymethylamino)-1-oxo-3-[[(8S,9R,13S,14R,17S)-3,4,17-trihydroxy-13-methyl-6,7,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthren-2-yl]sulanyl]propan-2-yl]amino]-5-oxopentanoic acid |
| Manual Xrefs | Databases |
|---|---|
| HMDB0060139 | HMDB |
| 35031697 | ChemSpider |