EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C29H37N3O8S |
| Net Charge | 0 |
| Average Mass | 587.695 |
| Monoisotopic Mass | 587.23014 |
| SMILES | NC(CCC(=O)NC(CSC(CCc1ccccc1)C(O)C(=O)CCc1ccccc1)C(=O)NCC(=O)O)C(=O)O |
| InChI | InChI=1S/C29H37N3O8S/c30-21(29(39)40)13-16-25(34)32-22(28(38)31-17-26(35)36)18-41-24(15-12-20-9-5-2-6-10-20)27(37)23(33)14-11-19-7-3-1-4-8-19/h1-10,21-22,24,27,37H,11-18,30H2,(H,31,38)(H,32,34)(H,35,36)(H,39,40) |
| InChIKey | UKVKYHHVYZVKBW-UHFFFAOYSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| synthetic microbial community (ncbitaxon:3229850) | Whole Organism (NCIT:C13413) | MetaboLights (MTBLS3129) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 2-amino-4-({1-[(carboxymethyl)-C-hydroxycarbonimidoyl]-2-[(4-hydroxy-5-oxo-1,7-diphenylheptan-3-yl)sulfanyl]ethyl}-C-hydroxycarbonimidoyl)butanoic acid (CHEBI:193915) is a peptide (CHEBI:16670) |
| IUPAC Name |
|---|
| 2-amino-5-[[1-(carboxymethylamino)-3-(4-hydroxy-5-oxo-1,7-diphenylheptan-3-yl)sulanyl-1-oxopropan-2-yl]amino]-5-oxopentanoic acid |