EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C24H37N3O8S |
| Net Charge | 0 |
| Average Mass | 527.640 |
| Monoisotopic Mass | 527.23014 |
| SMILES | CCCCCC(O)(CO)C(SCC(NC(=O)CCC(N)C(=O)O)C(=O)NCC(=O)O)c1ccccc1 |
| InChI | InChI=1S/C24H37N3O8S/c1-2-3-7-12-24(35,15-28)21(16-8-5-4-6-9-16)36-14-18(22(32)26-13-20(30)31)27-19(29)11-10-17(25)23(33)34/h4-6,8-9,17-18,21,28,35H,2-3,7,10-15,25H2,1H3,(H,26,32)(H,27,29)(H,30,31)(H,33,34) |
| InChIKey | WBVDSOCRKVQQNZ-UHFFFAOYSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| synthetic microbial community (ncbitaxon:3229850) | Whole Organism (NCIT:C13413) | MetaboLights (MTBLS3129) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 2-amino-4-({1-[(carboxymethyl)-C-hydroxycarbonimidoyl]-2-[(2,3-dihydroxy-2-pentyl-1-phenylpropyl)sulfanyl]ethyl}-C-hydroxycarbonimidoyl)butanoic acid (CHEBI:193910) is a peptide (CHEBI:16670) |
| IUPAC Name |
|---|
| 2-amino-5-[[1-(carboxymethylamino)-3-[2-hydroxy-2-(hydroxymethyl)-1-phenylheptyl]sulanyl-1-oxopropan-2-yl]amino]-5-oxopentanoic acid |