EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
CHEBI:193906 - Malformin
| Formula | C23H39N5O5S2 |
| Net Charge | 0 |
| Average Mass | 529.729 |
| Monoisotopic Mass | 529.23926 |
| SMILES | CCC(C)C1NC(=O)C(CC(C)C)NC(=O)C(C(C)C)NC(=O)C2CSSCC(NC1=O)C(=O)N2 |
| InChI | InChI=1S/C23H39N5O5S2/c1-7-13(6)18-23(33)26-15-9-34-35-10-16(25-20(15)30)21(31)27-17(12(4)5)22(32)24-14(8-11(2)3)19(29)28-18/h11-18H,7-10H2,1-6H3,(H,24,32)(H,25,30)(H,26,33)(H,27,31)(H,28,29) |
| InChIKey | RNCGDQLZIATDOU-UHFFFAOYSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| synthetic microbial community (ncbitaxon:3229850) | Whole Organism (NCIT:C13413) | MetaboLights (MTBLS3129) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Malformin (CHEBI:193906) is a cyclic peptide (CHEBI:23449) |
| IUPAC Name |
|---|
| 4-butan-2-yl-7-(2-methylpropyl)-10-propan-2-yl-15,16-dithia-2,5,8,11,19-pentazabicyclo[11.4.2]nonadecane-3,6,9,12,18-pentone |
| Manual Xrefs | Databases |
|---|---|
| 3865 | ChemSpider |
| HMDB0029429 | HMDB |
| Registry Numbers | Sources |
|---|---|
| CAS:3022-92-2 | ChemIDplus |