EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C28H30O9 |
| Net Charge | 0 |
| Average Mass | 510.539 |
| Monoisotopic Mass | 510.18898 |
| SMILES | CC1C(=O)OC2CC1(C)C1C3(O)C(=O)OC14C(O)(CCC1C3C=CC3=CC=CC(=O)C31C)C(=O)OC24C |
| InChI | InChI=1S/C28H30O9/c1-13-19(30)35-18-12-23(13,2)20-27(34)16-9-8-14-6-5-7-17(29)24(14,3)15(16)10-11-26(33)21(31)36-25(18,4)28(20,26)37-22(27)32/h5-9,13,15-16,18,20,33-34H,10-12H2,1-4H3 |
| InChIKey | NSFHPMKDYVTYOY-UHFFFAOYSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| synthetic microbial community (ncbitaxon:3229850) | Whole Organism (NCIT:C13413) | MetaboLights (MTBLS3129) |
| Roles Classification |
|---|
| Biological Role: | plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 25,27-Dihydro-4,7-didehydro-7-deoxyphysalin A (CHEBI:193901) is a physalin (CHEBI:76361) |
| IUPAC Name |
|---|
| 6,19-dihydroxy-1,15,22,26-tetramethyl-4,21,24-trioxaheptacyclo[21.3.1.02,6.03,19.03,22.07,16.010,15]heptacosa-8,10,12-triene-5,14,20,25-tetrone |
| Manual Xrefs | Databases |
|---|---|
| 35014861 | ChemSpider |
| HMDB0039696 | HMDB |