EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C16H19N3O4 |
| Net Charge | 0 |
| Average Mass | 317.345 |
| Monoisotopic Mass | 317.13756 |
| SMILES | O=C(O)C(Cc1cnc2ccccc12)NC(=O)C1CC(O)CN1 |
| InChI | InChI=1S/C16H19N3O4/c20-10-6-13(18-8-10)15(21)19-14(16(22)23)5-9-7-17-12-4-2-1-3-11(9)12/h1-4,7,10,13-14,17-18,20H,5-6,8H2,(H,19,21)(H,22,23) |
| InChIKey | PMCORMXOLUUGHL-UHFFFAOYSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| synthetic microbial community (ncbitaxon:3229850) | Whole Organism (NCIT:C13413) | MetaboLights (MTBLS3129) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Hydroxyprolyl-Tryptophan (CHEBI:193870) is a peptide (CHEBI:16670) |
| IUPAC Name |
|---|
| 2-[(4-hydroxypyrrolidine-2-carbonyl)amino]-3-(1H-indol-3-yl)propanoic acid |
| Manual Xrefs | Databases |
|---|---|
| HMDB0028874 | HMDB |
| 35032809 | ChemSpider |