EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C14H20ClNO4 |
| Net Charge | 0 |
| Average Mass | 301.770 |
| Monoisotopic Mass | 301.10809 |
| SMILES | CCCCNCC(O)COc1cc(C(=O)O)ccc1Cl |
| InChI | InChI=1S/C14H20ClNO4/c1-2-3-6-16-8-11(17)9-20-13-7-10(14(18)19)4-5-12(13)15/h4-5,7,11,16-17H,2-3,6,8-9H2,1H3,(H,18,19) |
| InChIKey | IZPPAHZRVDTEHO-UHFFFAOYSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| synthetic microbial community (ncbitaxon:3229850) | Whole Organism (NCIT:C13413) | MetaboLights (MTBLS3129) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Carboxybupranolol, 4-chloro-3-[3-(1,1-dimethylethylamino)-2-hydroxy-propyloxy]benzoic acid (CHEBI:193852) is a benzoic acids (CHEBI:22723) |
| Carboxybupranolol, 4-chloro-3-[3-(1,1-dimethylethylamino)-2-hydroxy-propyloxy]benzoic acid (CHEBI:193852) is a organohalogen compound (CHEBI:17792) |
| IUPAC Name |
|---|
| 3-[3-(butylamino)-2-hydroxypropoxy]-4-chlorobenzoic acid |
| Manual Xrefs | Databases |
|---|---|
| HMDB0061131 | HMDB |
| 157175 | ChemSpider |
| Registry Numbers | Sources |
|---|---|
| CAS:95148-50-8 | ChemIDplus |