EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
CHEBI:193836 - N6-beta-Aspartyllysine
| Formula | C10H19N3O5 |
| Net Charge | 0 |
| Average Mass | 261.278 |
| Monoisotopic Mass | 261.13247 |
| SMILES | N[C@@H](CCCCNC(=O)C[C@H](N)C(=O)O)C(=O)O |
| InChI | InChI=1S/C10H19N3O5/c11-6(9(15)16)3-1-2-4-13-8(14)5-7(12)10(17)18/h6-7H,1-5,11-12H2,(H,13,14)(H,15,16)(H,17,18)/t6-,7-/m0/s1 |
| InChIKey | VNJVIQOAVBMTIB-BQBZGAKWSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| synthetic microbial community (ncbitaxon:3229850) | Whole Organism (NCIT:C13413) | MetaboLights (MTBLS3129) |
| Roles Classification |
|---|
| Chemical Roles: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| N6-beta-Aspartyllysine (CHEBI:193836) is a L-α-amino acid (CHEBI:15705) |
| IUPAC Name |
|---|
| (2S)-2-amino-6-[[(3S)-3-amino-3-carboxypropanoyl]amino]hexanoic acid |