EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C10H16N2O6 |
| Net Charge | 0 |
| Average Mass | 260.246 |
| Monoisotopic Mass | 260.10084 |
| SMILES | N[C@@H](CCC(=O)O)C(=O)N1C[C@H](O)C[C@H]1C(=O)O |
| InChI | InChI=1S/C10H16N2O6/c11-6(1-2-8(14)15)9(16)12-4-5(13)3-7(12)10(17)18/h5-7,13H,1-4,11H2,(H,14,15)(H,17,18)/t5-,6+,7+/m1/s1 |
| InChIKey | NRSOKLBABRGMGJ-VQVTYTSYSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| synthetic microbial community (ncbitaxon:3229850) | Whole Organism (NCIT:C13413) | MetaboLights (MTBLS3129) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Glutamyl-Hydroxyproline (CHEBI:193834) is a dipeptide (CHEBI:46761) |
| IUPAC Name |
|---|
| (2S,4R)-1-[(2S)-2-amino-4-carboxybutanoyl]-4-hydroxypyrrolidine-2-carboxylic acid |