EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C5H10O8S |
| Net Charge | 0 |
| Average Mass | 230.194 |
| Monoisotopic Mass | 230.00964 |
| SMILES | O=C(O)C(CO)(CO)COS(=O)(=O)O |
| InChI | InChI=1S/C5H10O8S/c6-1-5(2-7,4(8)9)3-13-14(10,11)12/h6-7H,1-3H2,(H,8,9)(H,10,11,12) |
| InChIKey | QGNBYZCVGKYBME-UHFFFAOYSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| synthetic microbial community (ncbitaxon:3229850) | Whole Organism (NCIT:C13413) | MetaboLights (MTBLS3129) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 3-hydroxy-2-(hydroxymethyl)-2-[(sulfooxy)methyl]propanoic acid (CHEBI:193817) is a 3-hydroxy carboxylic acid (CHEBI:61355) |
| IUPAC Name |
|---|
| 2,2-bis(hydroxymethyl)-3-sulooxypropanoic acid |
| Manual Xrefs | Databases |
|---|---|
| 74851991 | ChemSpider |